C21H33N3O2S — CID 109442723
N'-(3-benzylsulfonylpropyl)-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109442723) has the molecular formula C21H33N3O2S and a molecular weight of 391.58 g/mol. Its IUPAC name is N'-(3-benzylsulfonylpropyl)-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N'-(3-benzylsulfonylpropyl)-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109442723 |
| Molecular Formula | C21H33N3O2S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N'-(3-benzylsulfonylpropyl)-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C21H33N3O2S/c1-2-22-21(24-15-19-11-6-7-12-20(19)16-24)23-13-8-14-27(25,26)17-18-9-4-3-5-10-18/h3-5,9-10,19-20H,2,6-8,11-17H2,1H3,(H,22,23) |
| InChIKey | PTFJSFBCKSXUOX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|