C17H28IN3O2S — CID 110956201
N'-(3-benzylsulfonylpropyl)-N-ethylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 110956201) has the molecular formula C17H28IN3O2S and a molecular weight of 465.40 g/mol. Its IUPAC name is N'-(3-benzylsulfonylpropyl)-N-ethylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(3-benzylsulfonylpropyl)-N-ethylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110956201 |
| Molecular Formula | C17H28IN3O2S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N'-(3-benzylsulfonylpropyl)-N-ethylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)N1CCCC1.I |
| InChI | InChI=1S/C17H27N3O2S.HI/c1-2-18-17(20-12-6-7-13-20)19-11-8-14-23(21,22)15-16-9-4-3-5-10-16;/h3-5,9-10H,2,6-8,11-15H2,1H3,(H,18,19);1H |
| InChIKey | WOSABTPYJNNGAP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|