C23H35IN4O — CID 109444286
N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109444286) has the molecular formula C23H35IN4O and a molecular weight of 510.46 g/mol. Its IUPAC name is N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109444286 |
| Molecular Formula | C23H35IN4O |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)N1Cc2ccccc2C1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C23H34N4O.HI/c1-2-24-23(27-16-20-10-5-6-11-21(20)17-27)25-13-7-12-22(28)26-14-18-8-3-4-9-19(18)15-26;/h3-4,8-9,20-21H,2,5-7,10-17H2,1H3,(H,24,25);1H |
| InChIKey | DVMMBSVWFNRIJI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|