C27H34N4O — CID 109415557
4-benzylidene-N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N-ethylpiperidine-1-carboximidamide (PubChem CID 109415557) has the molecular formula C27H34N4O and a molecular weight of 430.60 g/mol. Its IUPAC name is 4-benzylidene-N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N-ethylpiperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N-ethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109415557 |
| Molecular Formula | C27H34N4O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 4-benzylidene-N'-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N-ethylpiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCC(=O)N1Cc2ccccc2C1)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H34N4O/c1-2-28-27(30-17-14-23(15-18-30)19-22-9-4-3-5-10-22)29-16-8-13-26(32)31-20-24-11-6-7-12-25(24)21-31/h3-7,9-12,19H,2,8,13-18,20-21H2,1H3,(H,28,29) |
| InChIKey | LLYHALDARZQAKG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|