C24H30N6 — CID 109415244
4-benzylidene-N-ethyl-N'-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1-carboximidamide (PubChem CID 109415244) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is 4-benzylidene-N-ethyl-N'-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-ethyl-N'-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109415244 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 4-benzylidene-N-ethyl-N'-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nnc2ccccn12)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N6/c1-2-25-24(26-15-8-12-23-28-27-22-11-6-7-16-30(22)23)29-17-13-21(14-18-29)19-20-9-4-3-5-10-20/h3-7,9-11,16,19H,2,8,12-15,17-18H2,1H3,(H,25,26) |
| InChIKey | JTAPVFWHVXHMQB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|