C20H32N6 — CID 111743719
N-ethyl-3-pentan-3-yl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111743719) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is N-ethyl-3-pentan-3-yl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-pentan-3-yl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743719 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | N-ethyl-3-pentan-3-yl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)N1CCC(C(CC)CC)C1 |
| InChI | InChI=1S/C20H32N6/c1-4-16(5-2)17-11-14-25(15-17)20(21-6-3)22-12-10-19-24-23-18-9-7-8-13-26(18)19/h7-9,13,16-17H,4-6,10-12,14-15H2,1-3H3,(H,21,22) |
| InChIKey | UGYFXFAGYHYYAR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|