C20H30F3N7 — CID 111997063
N-ethyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111997063) has the molecular formula C20H30F3N7 and a molecular weight of 425.50 g/mol. Its IUPAC name is N-ethyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111997063 |
| Molecular Formula | C20H30F3N7 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-ethyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)N1CCC(CN(CC)CC(F)(F)F)C1 |
| InChI | InChI=1S/C20H30F3N7/c1-3-24-19(25-10-8-18-27-26-17-7-5-6-11-30(17)18)29-12-9-16(14-29)13-28(4-2)15-20(21,22)23/h5-7,11,16H,3-4,8-10,12-15H2,1-2H3,(H,24,25) |
| InChIKey | LPHDNDUSFDSIDB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|