C18H36F3IN4 — CID 111998214
N-ethyl-N'-(2-ethylbutyl)-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111998214) has the molecular formula C18H36F3IN4 and a molecular weight of 492.41 g/mol. Its IUPAC name is N-ethyl-N'-(2-ethylbutyl)-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-ethylbutyl)-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111998214 |
| Molecular Formula | C18H36F3IN4 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-ethyl-N'-(2-ethylbutyl)-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)CC)N1CCC(CN(CC)CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H35F3N4.HI/c1-5-15(6-2)11-23-17(22-7-3)25-10-9-16(13-25)12-24(8-4)14-18(19,20)21;/h15-16H,5-14H2,1-4H3,(H,22,23);1H |
| InChIKey | WEOWHUZNKSIYLC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|