C21H32F3N5O2 — CID 111997655
2-[3-[[[ethylamino-[3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidin-1-yl]methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111997655) has the molecular formula C21H32F3N5O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 2-[3-[[[ethylamino-[3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidin-1-yl]methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[ethylamino-[3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidin-1-yl]methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111997655 |
| Molecular Formula | C21H32F3N5O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 2-[3-[[[ethylamino-[3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidin-1-yl]methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)N1CCC(CN(CC)CC(F)(F)F)C1 |
| InChI | InChI=1S/C21H32F3N5O2/c1-3-26-20(27-11-16-6-5-7-18(10-16)31-14-19(25)30)29-9-8-17(13-29)12-28(4-2)15-21(22,23)24/h5-7,10,17H,3-4,8-9,11-15H2,1-2H3,(H2,25,30)(H,26,27) |
| InChIKey | MRSJHNINJGDJDP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|