C22H34F3N5O — CID 110042138
2-[[C-[3-(diethylaminomethyl)pyrrolidin-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbonimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110042138) has the molecular formula C22H34F3N5O and a molecular weight of 441.54 g/mol. Its IUPAC name is 2-[[C-[3-(diethylaminomethyl)pyrrolidin-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbonimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[C-[3-(diethylaminomethyl)pyrrolidin-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbonimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110042138 |
| Molecular Formula | C22H34F3N5O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 2-[[C-[3-(diethylaminomethyl)pyrrolidin-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbonimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCN(CC)CC1CCN(/C(=N/Cc2cccc(C(F)(F)F)c2)NCC(=O)N(C)C)C1 |
| InChI | InChI=1S/C22H34F3N5O/c1-5-29(6-2)15-18-10-11-30(16-18)21(27-14-20(31)28(3)4)26-13-17-8-7-9-19(12-17)22(23,24)25/h7-9,12,18H,5-6,10-11,13-16H2,1-4H3,(H,26,27) |
| InChIKey | ABYHOLTWUSXQKU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|