C19H28F3N5O2 — CID 111770127
N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 111770127) has the molecular formula C19H28F3N5O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111770127 |
| Molecular Formula | C19H28F3N5O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1cccc(C(F)(F)F)c1)NCCN1CCOCC1 |
| InChI | InChI=1S/C19H28F3N5O2/c1-26(2)17(28)14-25-18(23-6-7-27-8-10-29-11-9-27)24-13-15-4-3-5-16(12-15)19(20,21)22/h3-5,12H,6-11,13-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | JRIBRJXBJGJKSY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|