C18H23F3N6O — CID 111863183
N,N-dimethyl-2-[[N-[(2-methylpyrazol-3-yl)methyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 111863183) has the molecular formula C18H23F3N6O and a molecular weight of 396.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-[(2-methylpyrazol-3-yl)methyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-[(2-methylpyrazol-3-yl)methyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111863183 |
| Molecular Formula | C18H23F3N6O |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N,N-dimethyl-2-[[N-[(2-methylpyrazol-3-yl)methyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1ccnn1C |
| InChI | InChI=1S/C18H23F3N6O/c1-26(2)16(28)12-24-17(23-11-15-7-8-25-27(15)3)22-10-13-5-4-6-14(9-13)18(19,20)21/h4-9H,10-12H2,1-3H3,(H2,22,23,24) |
| InChIKey | KCPKIEROZXYGFW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|