C21H25F4IN4O — CID 111862846
2-[[N-[2-(2-fluorophenyl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111862846) has the molecular formula C21H25F4IN4O and a molecular weight of 552.35 g/mol. Its IUPAC name is 2-[[N-[2-(2-fluorophenyl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[2-(2-fluorophenyl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111862846 |
| Molecular Formula | C21H25F4IN4O |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 2-[[N-[2-(2-fluorophenyl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1cccc(C(F)(F)F)c1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C21H24F4N4O.HI/c1-29(2)19(30)14-28-20(26-11-10-16-7-3-4-9-18(16)22)27-13-15-6-5-8-17(12-15)21(23,24)25;/h3-9,12H,10-11,13-14H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | CVBPDPQSOJBKCW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|