C19H23F3N4O2 — CID 111862361
2-[[N-[2-(furan-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111862361) has the molecular formula C19H23F3N4O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is 2-[[N-[2-(furan-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-[2-(furan-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111862361 |
| Molecular Formula | C19H23F3N4O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[[N-[2-(furan-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1cccc(C(F)(F)F)c1)NCCc1ccco1 |
| InChI | InChI=1S/C19H23F3N4O2/c1-26(2)17(27)13-25-18(23-9-8-16-7-4-10-28-16)24-12-14-5-3-6-15(11-14)19(20,21)22/h3-7,10-11H,8-9,12-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | YIRBVMJYMYUYOV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|