C20H25F3N4O2 — CID 111862414
N-[3-[[N-[2-(furan-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propyl]acetamide (PubChem CID 111862414) has the molecular formula C20H25F3N4O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is N-[3-[[N-[2-(furan-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propyl]acetamide.
| Compound Name | N-[3-[[N-[2-(furan-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 111862414 |
| Molecular Formula | C20H25F3N4O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[3-[[N-[2-(furan-2-yl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propyl]acetamide |
| SMILES | CC(=O)NCCCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCc1ccco1 |
| InChI | InChI=1S/C20H25F3N4O2/c1-15(28)24-9-4-10-25-19(26-11-8-18-7-3-12-29-18)27-14-16-5-2-6-17(13-16)20(21,22)23/h2-3,5-7,12-13H,4,8-11,14H2,1H3,(H,24,28)(H2,25,26,27) |
| InChIKey | OBGXDXTWMCIVAJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|