C22H31F3IN3O2 — CID 110050739
1-[2-(furan-2-yl)ethyl]-3-(4-methoxy-2,2-dimethylbutyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110050739) has the molecular formula C22H31F3IN3O2 and a molecular weight of 553.41 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(4-methoxy-2,2-dimethylbutyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(4-methoxy-2,2-dimethylbutyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110050739 |
| Molecular Formula | C22H31F3IN3O2 |
| Molecular Weight | 553.41 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(4-methoxy-2,2-dimethylbutyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COCCC(C)(C)CN/C(=N/Cc1cccc(C(F)(F)F)c1)NCCc1ccco1.I |
| InChI | InChI=1S/C22H30F3N3O2.HI/c1-21(2,10-13-29-3)16-28-20(26-11-9-19-8-5-12-30-19)27-15-17-6-4-7-18(14-17)22(23,24)25;/h4-8,12,14H,9-11,13,15-16H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | JMVMTAZYEBOZKR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|