C19H25F3IN3O2 — CID 111267854
1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111267854) has the molecular formula C19H25F3IN3O2 and a molecular weight of 511.33 g/mol. Its IUPAC name is 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111267854 |
| Molecular Formula | C19H25F3IN3O2 |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCCOCc1ccco1.I |
| InChI | InChI=1S/C19H24F3N3O2.HI/c1-2-23-18(24-9-5-10-26-14-17-8-4-11-27-17)25-13-15-6-3-7-16(12-15)19(20,21)22;/h3-4,6-8,11-12H,2,5,9-10,13-14H2,1H3,(H2,23,24,25);1H |
| InChIKey | HJASEUPJNQHHMK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|