C18H25FIN3O3 — CID 111797691
1-ethyl-2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111797691) has the molecular formula C18H25FIN3O3 and a molecular weight of 477.32 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111797691 |
| Molecular Formula | C18H25FIN3O3 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(O)c(F)c1)NCCCOCc1ccco1.I |
| InChI | InChI=1S/C18H24FN3O3.HI/c1-2-20-18(22-12-14-6-7-17(23)16(19)11-14)21-8-4-9-24-13-15-5-3-10-25-15;/h3,5-7,10-11,23H,2,4,8-9,12-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | NRQVXLXZDGSBFR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|