C21H32IN3O2 — CID 110052841
2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(4-methoxy-2,2-dimethylbutyl)guanidine;hydroiodide (PubChem CID 110052841) has the molecular formula C21H32IN3O2 and a molecular weight of 485.41 g/mol. Its IUPAC name is 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(4-methoxy-2,2-dimethylbutyl)guanidine;hydroiodide.
| Compound Name | 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(4-methoxy-2,2-dimethylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110052841 |
| Molecular Formula | C21H32IN3O2 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(4-methoxy-2,2-dimethylbutyl)guanidine;hydroiodide |
| SMILES | COCCC(C)(C)CN/C(=N/Cc1ccccc1)NCCc1ccco1.I |
| InChI | InChI=1S/C21H31N3O2.HI/c1-21(2,12-15-25-3)17-24-20(22-13-11-19-10-7-14-26-19)23-16-18-8-5-4-6-9-18;/h4-10,14H,11-13,15-17H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | WAPMNOBOEOOPPR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|