C21H31N3O2 — CID 111711473
2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(2-methoxy-3,3-dimethylbutyl)guanidine (PubChem CID 111711473) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(2-methoxy-3,3-dimethylbutyl)guanidine.
| Compound Name | 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(2-methoxy-3,3-dimethylbutyl)guanidine |
|---|---|
| PubChem CID | 111711473 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(2-methoxy-3,3-dimethylbutyl)guanidine |
| SMILES | COC(CN/C(=N/Cc1ccccc1)NCCc1ccco1)C(C)(C)C |
| InChI | InChI=1S/C21H31N3O2/c1-21(2,3)19(25-4)16-24-20(22-13-12-18-11-8-14-26-18)23-15-17-9-6-5-7-10-17/h5-11,14,19H,12-13,15-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | TVLAKYDIAFHWQW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|