C20H30IN3O2 — CID 110052755
2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(6-hydroxyhexyl)guanidine;hydroiodide (PubChem CID 110052755) has the molecular formula C20H30IN3O2 and a molecular weight of 471.38 g/mol. Its IUPAC name is 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(6-hydroxyhexyl)guanidine;hydroiodide.
| Compound Name | 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(6-hydroxyhexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110052755 |
| Molecular Formula | C20H30IN3O2 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(6-hydroxyhexyl)guanidine;hydroiodide |
| SMILES | I.OCCCCCCN/C(=N\Cc1ccccc1)NCCc1ccco1 |
| InChI | InChI=1S/C20H29N3O2.HI/c24-15-7-2-1-6-13-21-20(22-14-12-19-11-8-16-25-19)23-17-18-9-4-3-5-10-18;/h3-5,8-11,16,24H,1-2,6-7,12-15,17H2,(H2,21,22,23);1H |
| InChIKey | GLFLRMLJMLWUSQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|