C24H31F3IN3O2 — CID 110060401
1-[2-(furan-2-yl)ethyl]-3-(6-oxaspiro[4.5]decan-9-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110060401) has the molecular formula C24H31F3IN3O2 and a molecular weight of 577.43 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(6-oxaspiro[4.5]decan-9-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(6-oxaspiro[4.5]decan-9-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110060401 |
| Molecular Formula | C24H31F3IN3O2 |
| Molecular Weight | 577.43 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(6-oxaspiro[4.5]decan-9-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | FC(F)(F)c1cccc(C/N=C(\NCCc2ccco2)NC2CCOC3(CCCC3)C2)c1.I |
| InChI | InChI=1S/C24H30F3N3O2.HI/c25-24(26,27)19-6-3-5-18(15-19)17-29-22(28-12-8-21-7-4-13-31-21)30-20-9-14-32-23(16-20)10-1-2-11-23;/h3-7,13,15,20H,1-2,8-12,14,16-17H2,(H2,28,29,30);1H |
| InChIKey | GSYONSNSSUXITQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|