C21H27F3IN3O2 — CID 109385784
3-[2-(furan-2-yl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109385784) has the molecular formula C21H27F3IN3O2 and a molecular weight of 537.36 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-(furan-2-yl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109385784 |
| Molecular Formula | C21H27F3IN3O2 |
| Molecular Weight | 537.36 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 3-[2-(furan-2-yl)ethyl]-1-methyl-1-(oxolan-3-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CN(CC1CCOC1)/C(=N/Cc1cccc(C(F)(F)F)c1)NCCc1ccco1.I |
| InChI | InChI=1S/C21H26F3N3O2.HI/c1-27(14-17-8-11-28-15-17)20(25-9-7-19-6-3-10-29-19)26-13-16-4-2-5-18(12-16)21(22,23)24;/h2-6,10,12,17H,7-9,11,13-15H2,1H3,(H,25,26);1H |
| InChIKey | OGWJOAVIADOXFK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|