C22H33F3IN3O2 — CID 109382895
3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 109382895) has the molecular formula C22H33F3IN3O2 and a molecular weight of 555.42 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109382895 |
| Molecular Formula | C22H33F3IN3O2 |
| Molecular Weight | 555.42 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | 3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)-2-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(C(F)(F)F)c2)CCOCC1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C22H32F3N3O2.HI/c1-3-26-20(28(2)14-17-7-10-30-15-17)27-16-21(8-11-29-12-9-21)18-5-4-6-19(13-18)22(23,24)25;/h4-6,13,17H,3,7-12,14-16H2,1-2H3,(H,26,27);1H |
| InChIKey | RTGSRLOEVUQBCA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|