C21H23F3N6O — CID 110055708
1-[2-(furan-2-yl)ethyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 110055708) has the molecular formula C21H23F3N6O and a molecular weight of 432.45 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110055708 |
| Molecular Formula | C21H23F3N6O |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | FC(F)(F)c1cccc(C/N=C(\NCCc2ccco2)NC2CCc3ncnn3C2)c1 |
| InChI | InChI=1S/C21H23F3N6O/c22-21(23,24)16-4-1-3-15(11-16)12-26-20(25-9-8-18-5-2-10-31-18)29-17-6-7-19-27-14-28-30(19)13-17/h1-5,10-11,14,17H,6-9,12-13H2,(H2,25,26,29) |
| InChIKey | HCEKOKGBNCKPFE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|