C20H31F3N4O2 — CID 111863221
N,N-dimethyl-2-[[N-[3-(2-methylpropoxy)propyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 111863221) has the molecular formula C20H31F3N4O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-[3-(2-methylpropoxy)propyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-[3-(2-methylpropoxy)propyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111863221 |
| Molecular Formula | C20H31F3N4O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | N,N-dimethyl-2-[[N-[3-(2-methylpropoxy)propyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CC(C)COCCCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCC(=O)N(C)C |
| InChI | InChI=1S/C20H31F3N4O2/c1-15(2)14-29-10-6-9-24-19(26-13-18(28)27(3)4)25-12-16-7-5-8-17(11-16)20(21,22)23/h5,7-8,11,15H,6,9-10,12-14H2,1-4H3,(H2,24,25,26) |
| InChIKey | OTBXEWMSEKFKFV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|