C22H35F3IN5O — CID 110035748
N,N-dimethyl-2-[[N-(3-piperidin-1-ylbutyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 110035748) has the molecular formula C22H35F3IN5O and a molecular weight of 569.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(3-piperidin-1-ylbutyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N-(3-piperidin-1-ylbutyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110035748 |
| Molecular Formula | C22H35F3IN5O |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | N,N-dimethyl-2-[[N-(3-piperidin-1-ylbutyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CC(CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCC(=O)N(C)C)N1CCCCC1.I |
| InChI | InChI=1S/C22H34F3N5O.HI/c1-17(30-12-5-4-6-13-30)10-11-26-21(28-16-20(31)29(2)3)27-15-18-8-7-9-19(14-18)22(23,24)25;/h7-9,14,17H,4-6,10-13,15-16H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | FIKXZJIERRXFSG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|