C21H30F3N5O — CID 110038883
2-[[N-(1-cyclopropylpiperidin-4-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110038883) has the molecular formula C21H30F3N5O and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-[[N-(1-cyclopropylpiperidin-4-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-(1-cyclopropylpiperidin-4-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110038883 |
| Molecular Formula | C21H30F3N5O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-[[N-(1-cyclopropylpiperidin-4-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1cccc(C(F)(F)F)c1)NC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C21H30F3N5O/c1-28(2)19(30)14-26-20(27-17-8-10-29(11-9-17)18-6-7-18)25-13-15-4-3-5-16(12-15)21(22,23)24/h3-5,12,17-18H,6-11,13-14H2,1-2H3,(H2,25,26,27) |
| InChIKey | FMFKZNDYYJOSSO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|