C21H32F3N5O — CID 110039071
2-[[C-[3-(diethylamino)pyrrolidin-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbonimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110039071) has the molecular formula C21H32F3N5O and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-[[C-[3-(diethylamino)pyrrolidin-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbonimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[C-[3-(diethylamino)pyrrolidin-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbonimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110039071 |
| Molecular Formula | C21H32F3N5O |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 2-[[C-[3-(diethylamino)pyrrolidin-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbonimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCN(CC)C1CCN(/C(=N/Cc2cccc(C(F)(F)F)c2)NCC(=O)N(C)C)C1 |
| InChI | InChI=1S/C21H32F3N5O/c1-5-28(6-2)18-10-11-29(15-18)20(26-14-19(30)27(3)4)25-13-16-8-7-9-17(12-16)21(22,23)24/h7-9,12,18H,5-6,10-11,13-15H2,1-4H3,(H,25,26) |
| InChIKey | QTBVNVFPYIGSGW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|