C19H28F3N5O — CID 111363663
2-[[ethylamino-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111363663) has the molecular formula C19H28F3N5O and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-[[ethylamino-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[ethylamino-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111363663 |
| Molecular Formula | C19H28F3N5O |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-[[ethylamino-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H28F3N5O/c1-4-23-18(24-13-17(28)25(2)3)27-10-8-26(9-11-27)14-15-6-5-7-16(12-15)19(20,21)22/h5-7,12H,4,8-11,13-14H2,1-3H3,(H,23,24) |
| InChIKey | OVYYQIQURKBDAT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|