C22H30ClN5O2 — CID 110053630
2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110053630) has the molecular formula C22H30ClN5O2 and a molecular weight of 431.97 g/mol. Its IUPAC name is 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110053630 |
| Molecular Formula | C22H30ClN5O2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccco1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H30ClN5O2/c1-26(2)21(29)16-25-22(24-9-8-20-7-4-14-30-20)28-12-10-27(11-13-28)17-18-5-3-6-19(23)15-18/h3-7,14-15H,8-13,16-17H2,1-2H3,(H,24,25) |
| InChIKey | HHJDTWNCRWBVKO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|