C20H34N6O4 — CID 110053818
2-[[[2-(furan-2-yl)ethylamino]-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110053818) has the molecular formula C20H34N6O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[[[2-(furan-2-yl)ethylamino]-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(furan-2-yl)ethylamino]-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110053818 |
| Molecular Formula | C20H34N6O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-[[[2-(furan-2-yl)ethylamino]-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCNC(=O)CN1CCN(/C(=N/CC(=O)N(C)C)NCCc2ccco2)CC1 |
| InChI | InChI=1S/C20H34N6O4/c1-24(2)19(28)15-23-20(22-7-6-17-5-4-13-30-17)26-11-9-25(10-12-26)16-18(27)21-8-14-29-3/h4-5,13H,6-12,14-16H2,1-3H3,(H,21,27)(H,22,23) |
| InChIKey | YWHCNUYYKYBQEO-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|