C21H36IN5O4 — CID 111659936
2-[4-[N-[2-(furan-2-yl)ethyl]-N'-(oxolan-2-ylmethyl)carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111659936) has the molecular formula C21H36IN5O4 and a molecular weight of 549.45 g/mol. Its IUPAC name is 2-[4-[N-[2-(furan-2-yl)ethyl]-N'-(oxolan-2-ylmethyl)carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[4-[N-[2-(furan-2-yl)ethyl]-N'-(oxolan-2-ylmethyl)carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111659936 |
| Molecular Formula | C21H36IN5O4 |
| Molecular Weight | 549.45 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 2-[4-[N-[2-(furan-2-yl)ethyl]-N'-(oxolan-2-ylmethyl)carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | COCCNC(=O)CN1CCN(/C(=N/CC2CCCO2)NCCc2ccco2)CC1.I |
| InChI | InChI=1S/C21H35N5O4.HI/c1-28-15-8-22-20(27)17-25-9-11-26(12-10-25)21(24-16-19-5-3-14-30-19)23-7-6-18-4-2-13-29-18;/h2,4,13,19H,3,5-12,14-17H2,1H3,(H,22,27)(H,23,24);1H |
| InChIKey | RFXTVZAJPZGQMZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|