C23H37N3O4 — CID 110057122
N-[2-(furan-2-yl)ethyl]-4-(oxan-2-ylmethoxy)-N'-(oxolan-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 110057122) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-4-(oxan-2-ylmethoxy)-N'-(oxolan-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-4-(oxan-2-ylmethoxy)-N'-(oxolan-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110057122 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-4-(oxan-2-ylmethoxy)-N'-(oxolan-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | c1coc(CCN/C(=N\CC2CCCO2)N2CCC(OCC3CCCCO3)CC2)c1 |
| InChI | InChI=1S/C23H37N3O4/c1-2-14-29-22(5-1)18-30-20-9-12-26(13-10-20)23(25-17-21-7-4-16-28-21)24-11-8-19-6-3-15-27-19/h3,6,15,20-22H,1-2,4-5,7-14,16-18H2,(H,24,25) |
| InChIKey | OZHOCWKXBUBJNA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|