C24H39N3O3 — CID 110057376
N'-(cyclohexylmethyl)-N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 110057376) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is N'-(cyclohexylmethyl)-N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-(cyclohexylmethyl)-N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110057376 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | N'-(cyclohexylmethyl)-N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | c1coc(CCN/C(=N\CC2CCCCC2)N2CCC(OCC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C24H39N3O3/c1-2-6-20(7-3-1)18-26-24(25-13-10-21-8-4-16-28-21)27-14-11-22(12-15-27)30-19-23-9-5-17-29-23/h4,8,16,20,22-23H,1-3,5-7,9-15,17-19H2,(H,25,26) |
| InChIKey | HDTCFSGAIWDDJH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|