C22H31N3O3S — CID 110057366
N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 110057366) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110057366 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | c1coc(CCN/C(=N\Cc2cccs2)N2CCC(OCC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C22H31N3O3S/c1-4-18(26-13-1)7-10-23-22(24-16-21-6-3-15-29-21)25-11-8-19(9-12-25)28-17-20-5-2-14-27-20/h1,3-4,6,13,15,19-20H,2,5,7-12,14,16-17H2,(H,23,24) |
| InChIKey | NYDXQXSMRUBVKS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|