C19H32IN3O3 — CID 109449548
N-ethyl-N'-(furan-2-ylmethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109449548) has the molecular formula C19H32IN3O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is N-ethyl-N'-(furan-2-ylmethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(furan-2-ylmethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109449548 |
| Molecular Formula | C19H32IN3O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-ethyl-N'-(furan-2-ylmethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C19H31N3O3.HI/c1-2-20-19(21-14-17-7-5-13-23-17)22-10-8-16(9-11-22)25-15-18-6-3-4-12-24-18;/h5,7,13,16,18H,2-4,6,8-12,14-15H2,1H3,(H,20,21);1H |
| InChIKey | JDSKTATVTWUBIF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|