C24H35IN4O3 — CID 109448524
N-ethyl-4-(oxan-2-ylmethoxy)-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 109448524) has the molecular formula C24H35IN4O3 and a molecular weight of 554.47 g/mol. Its IUPAC name is N-ethyl-4-(oxan-2-ylmethoxy)-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109448524 |
| Molecular Formula | C24H35IN4O3 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C24H34N4O3.HI/c1-2-25-24(26-16-20-17-31-23(27-20)19-8-4-3-5-9-19)28-13-11-21(12-14-28)30-18-22-10-6-7-15-29-22;/h3-5,8-9,17,21-22H,2,6-7,10-16,18H2,1H3,(H,25,26);1H |
| InChIKey | LJLUEWPUHNOEAE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|