C19H31N3O2S — CID 109448637
N-ethyl-4-(oxan-2-ylmethoxy)-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 109448637) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is N-ethyl-4-(oxan-2-ylmethoxy)-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109448637 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccs1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C19H31N3O2S/c1-2-20-19(21-14-18-7-5-13-25-18)22-10-8-16(9-11-22)24-15-17-6-3-4-12-23-17/h5,7,13,16-17H,2-4,6,8-12,14-15H2,1H3,(H,20,21) |
| InChIKey | CBIDMCYXJYTYHE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|