C22H39IN4O2S — CID 109449510
N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109449510) has the molecular formula C22H39IN4O2S and a molecular weight of 550.55 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109449510 |
| Molecular Formula | C22H39IN4O2S |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N(C)C)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C22H38N4O2S.HI/c1-4-23-22(24-16-20(25(2)3)21-9-7-15-29-21)26-12-10-18(11-13-26)28-17-19-8-5-6-14-27-19;/h7,9,15,18-20H,4-6,8,10-14,16-17H2,1-3H3,(H,23,24);1H |
| InChIKey | SXYPLIBJEWXFOU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|