C22H45IN4O3 — CID 109446934
N'-[4-(dimethylamino)-2-ethoxybutyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109446934) has the molecular formula C22H45IN4O3 and a molecular weight of 540.53 g/mol. Its IUPAC name is N'-[4-(dimethylamino)-2-ethoxybutyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[4-(dimethylamino)-2-ethoxybutyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109446934 |
| Molecular Formula | C22H45IN4O3 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | N'-[4-(dimethylamino)-2-ethoxybutyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CCN(C)C)OCC)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C22H44N4O3.HI/c1-5-23-22(24-17-20(27-6-2)10-13-25(3)4)26-14-11-19(12-15-26)29-18-21-9-7-8-16-28-21;/h19-21H,5-18H2,1-4H3,(H,23,24);1H |
| InChIKey | SNKBNRRQMUYPQP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|