C18H35IN4O3 — CID 109447610
N-ethyl-2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]acetamide;hydroiodide (PubChem CID 109447610) has the molecular formula C18H35IN4O3 and a molecular weight of 482.41 g/mol. Its IUPAC name is N-ethyl-2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-ethyl-2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109447610 |
| Molecular Formula | C18H35IN4O3 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-ethyl-2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCNC(=O)C/N=C(\NCC)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C18H34N4O3.HI/c1-3-19-17(23)13-21-18(20-4-2)22-10-8-15(9-11-22)25-14-16-7-5-6-12-24-16;/h15-16H,3-14H2,1-2H3,(H,19,23)(H,20,21);1H |
| InChIKey | YMNGTLCURSDPTF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|