C17H34IN3O4S — CID 109447116
N-ethyl-N'-(2-methylsulfonylethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109447116) has the molecular formula C17H34IN3O4S and a molecular weight of 503.45 g/mol. Its IUPAC name is N-ethyl-N'-(2-methylsulfonylethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-methylsulfonylethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109447116 |
| Molecular Formula | C17H34IN3O4S |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-ethyl-N'-(2-methylsulfonylethyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(C)(=O)=O)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C17H33N3O4S.HI/c1-3-18-17(19-9-13-25(2,21)22)20-10-7-15(8-11-20)24-14-16-6-4-5-12-23-16;/h15-16H,3-14H2,1-2H3,(H,18,19);1H |
| InChIKey | FLGGJSDCNHJFNV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|