C23H42N4O3 — CID 109449029
N-[2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]ethyl]cyclohexanecarboxamide (PubChem CID 109449029) has the molecular formula C23H42N4O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is N-[2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 109449029 |
| Molecular Formula | C23H42N4O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | N-[2-[[ethylamino-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methylidene]amino]ethyl]cyclohexanecarboxamide |
| SMILES | CCN/C(=N\CCNC(=O)C1CCCCC1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C23H42N4O3/c1-2-24-23(26-14-13-25-22(28)19-8-4-3-5-9-19)27-15-11-20(12-16-27)30-18-21-10-6-7-17-29-21/h19-21H,2-18H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | KHIZSTNNTFGHKB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|