C23H46N4O2 — CID 109449459
N'-[3-(dipropylamino)propyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109449459) has the molecular formula C23H46N4O2 and a molecular weight of 410.65 g/mol. Its IUPAC name is N'-[3-(dipropylamino)propyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-[3-(dipropylamino)propyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109449459 |
| Molecular Formula | C23H46N4O2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.36 |
| IUPAC Name | N'-[3-(dipropylamino)propyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCCN(CCC)CCC/N=C(\NCC)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C23H46N4O2/c1-4-14-26(15-5-2)16-9-13-25-23(24-6-3)27-17-11-21(12-18-27)29-20-22-10-7-8-19-28-22/h21-22H,4-20H2,1-3H3,(H,24,25) |
| InChIKey | DGCLJBOPHXFSRE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|