C19H34F3N3O2 — CID 109447481
N-ethyl-4-(oxan-2-ylmethoxy)-N'-(5,5,5-trifluoropentyl)piperidine-1-carboximidamide (PubChem CID 109447481) has the molecular formula C19H34F3N3O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-ethyl-4-(oxan-2-ylmethoxy)-N'-(5,5,5-trifluoropentyl)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-(5,5,5-trifluoropentyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447481 |
| Molecular Formula | C19H34F3N3O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-(5,5,5-trifluoropentyl)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCC(F)(F)F)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C19H34F3N3O2/c1-2-23-18(24-11-5-4-10-19(20,21)22)25-12-8-16(9-13-25)27-15-17-7-3-6-14-26-17/h16-17H,2-15H2,1H3,(H,23,24) |
| InChIKey | UBLPUDWCDKLABV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|