C22H41N3O3 — CID 109449097
N'-(3-cyclopentyloxypropyl)-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109449097) has the molecular formula C22H41N3O3 and a molecular weight of 395.59 g/mol. Its IUPAC name is N'-(3-cyclopentyloxypropyl)-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-(3-cyclopentyloxypropyl)-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109449097 |
| Molecular Formula | C22H41N3O3 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.31 |
| IUPAC Name | N'-(3-cyclopentyloxypropyl)-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCOC1CCCC1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C22H41N3O3/c1-2-23-22(24-13-7-17-26-19-8-3-4-9-19)25-14-11-20(12-15-25)28-18-21-10-5-6-16-27-21/h19-21H,2-18H2,1H3,(H,23,24) |
| InChIKey | UTUHKAMZICEFQK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|