C20H40N4O4S — CID 109448571
N-ethyl-N'-[3-[ethylsulfonyl(methyl)amino]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109448571) has the molecular formula C20H40N4O4S and a molecular weight of 432.63 g/mol. Its IUPAC name is N-ethyl-N'-[3-[ethylsulfonyl(methyl)amino]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-[ethylsulfonyl(methyl)amino]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109448571 |
| Molecular Formula | C20H40N4O4S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | N-ethyl-N'-[3-[ethylsulfonyl(methyl)amino]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(C)S(=O)(=O)CC)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C20H40N4O4S/c1-4-21-20(22-12-8-13-23(3)29(25,26)5-2)24-14-10-18(11-15-24)28-17-19-9-6-7-16-27-19/h18-19H,4-17H2,1-3H3,(H,21,22) |
| InChIKey | XBLZJDVLWRYZAV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|