C22H42IN3O2 — CID 109448680
N-ethyl-N'-[(4-methylcyclohexyl)methyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109448680) has the molecular formula C22H42IN3O2 and a molecular weight of 507.50 g/mol. Its IUPAC name is N-ethyl-N'-[(4-methylcyclohexyl)methyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(4-methylcyclohexyl)methyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109448680 |
| Molecular Formula | C22H42IN3O2 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-ethyl-N'-[(4-methylcyclohexyl)methyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCC(C)CC1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C22H41N3O2.HI/c1-3-23-22(24-16-19-9-7-18(2)8-10-19)25-13-11-20(12-14-25)27-17-21-6-4-5-15-26-21;/h18-21H,3-17H2,1-2H3,(H,23,24);1H |
| InChIKey | NMUWUDKNUHWAMT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|