C21H42N4O3 — CID 109447175
N-[4-(dimethylamino)-2-ethoxybutyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447175) has the molecular formula C21H42N4O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-ethoxybutyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[4-(dimethylamino)-2-ethoxybutyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447175 |
| Molecular Formula | C21H42N4O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | N-[4-(dimethylamino)-2-ethoxybutyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCOC(CCN(C)C)CN/C(=N\C)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H42N4O3/c1-5-26-19(9-12-24(3)4)16-23-21(22-2)25-13-10-18(11-14-25)28-17-20-8-6-7-15-27-20/h18-20H,5-17H2,1-4H3,(H,22,23) |
| InChIKey | ZAWJLUMLKWVAHL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|